C13H16F9NO — CID 21020749
N-butyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-yl)prop-2-enamide (PubChem CID 21020749) has the molecular formula C13H16F9NO and a molecular weight of 373.26 g/mol. Its IUPAC name is N-butyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-yl)prop-2-enamide.
| Compound Name | N-butyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21020749 |
| Molecular Formula | C13H16F9NO |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-butyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCCC)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F9NO/c1-4-6-7-23(9(24)5-2)8(3)10(14,15)11(16,17)12(18,19)13(20,21)22/h5,8H,2,4,6-7H2,1,3H3 |
| InChIKey | GCZMJWFXRVUCCV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|