C11H12F9NO — CID 21020764
N-ethyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide (PubChem CID 21020764) has the molecular formula C11H12F9NO and a molecular weight of 345.21 g/mol. Its IUPAC name is N-ethyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide.
| Compound Name | N-ethyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 21020764 |
| Molecular Formula | C11H12F9NO |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-ethyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F9NO/c1-3-7(22)21(4-2)6-5-8(12,13)9(14,15)10(16,17)11(18,19)20/h3H,1,4-6H2,2H3 |
| InChIKey | ZTPDOUSGTNXUJJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|