C20H24F12O2 — CID 21020791
2-[3-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-1-adamantyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21020791) has the molecular formula C20H24F12O2 and a molecular weight of 524.39 g/mol. Its IUPAC name is 2-[3-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-1-adamantyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-1-adamantyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21020791 |
| Molecular Formula | C20H24F12O2 |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[3-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-1-adamantyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)OC(C(F)(F)F)(C(F)(F)F)C12CC3CC(CC(C(O)(C(F)(F)F)C(F)(F)F)(C3)C1)C2 |
| InChI | InChI=1S/C20H24F12O2/c1-3-10(2)34-16(19(27,28)29,20(30,31)32)14-7-11-4-12(8-14)6-13(5-11,9-14)15(33,17(21,22)23)18(24,25)26/h10-12,33H,3-9H2,1-2H3 |
| InChIKey | QQMBQVYSHXSKOR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |