C13H20F6O — CID 21020793
2-(4-butan-2-ylcyclohexyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21020793) has the molecular formula C13H20F6O and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-(4-butan-2-ylcyclohexyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-butan-2-ylcyclohexyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21020793 |
| Molecular Formula | C13H20F6O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(4-butan-2-ylcyclohexyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H20F6O/c1-3-8(2)9-4-6-10(7-5-9)11(20,12(14,15)16)13(17,18)19/h8-10,20H,3-7H2,1-2H3 |
| InChIKey | FKVSIFJABVINJE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |