About N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide
N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide (PubChem CID 21021033) has the molecular formula C11H21N3O2S
and a molecular weight of 259.38 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide |
| PubChem CID | 21021033 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C11H21N3O2S/c1-11(2,3)6-5-7-13-17(15,16)10-8-14(4)9-12-10/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | SVGZXWZVYYRSQV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide?
The IUPAC name of N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide (CID 21021033) is N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide.
What is the SMILES notation for N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide?
The canonical SMILES for N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide is Cn1cnc(S(=O)(=O)NCCCC(C)(C)C)c1.
What is the InChIKey of N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide?
The InChIKey is SVGZXWZVYYRSQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2S/c1-11(2,3)6-5-7-13-17(15,16)10-8-14(4)9-12-10/h8-9,13H,5-7H2,1-4H3.
What are the key properties of N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide?
N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide has a molecular weight of 259.38 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylpentyl)-1-methylimidazole-4-sulfonamide is sourced from PubChem (CID 21021033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).