C15H31N5OS — CID 2102121
2-[2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol (PubChem CID 2102121) has the molecular formula C15H31N5OS and a molecular weight of 329.51 g/mol. Its IUPAC name is 2-[2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol.
| Compound Name | 2-[2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol |
|---|---|
| PubChem CID | 2102121 |
| Molecular Formula | C15H31N5OS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-[2-[[4-butyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol |
| SMILES | CCCCn1c(SCCNCCO)nnc1[C@@H](CC)N(C)C |
| InChI | InChI=1S/C15H31N5OS/c1-5-7-10-20-14(13(6-2)19(3)4)17-18-15(20)22-12-9-16-8-11-21/h13,16,21H,5-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | JARUMEMTFKAUOJ-CYBMUJFWSA-N |
| XLogP | 1.76 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|