About 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol
4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol (PubChem CID 21021600) has the molecular formula C15H19NO5
and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol |
| PubChem CID | 21021600 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol |
| SMILES | OCC1=CC(/N=C/C(O)c2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C15H19NO5/c17-8-10-6-11(14(20)15(21)13(10)19)16-7-12(18)9-4-2-1-3-5-9/h1-7,11-15,17-21H,8H2/b16-7+ |
| InChIKey | ORYIKKKRHHCTNY-FRKPEAEDSA-N |
| XLogP | -0.83 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol?
The IUPAC name of 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol (CID 21021600) is 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol.
What is the SMILES notation for 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol?
The canonical SMILES for 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol is OCC1=CC(/N=C/C(O)c2ccccc2)C(O)C(O)C1O.
What is the InChIKey of 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol?
The InChIKey is ORYIKKKRHHCTNY-FRKPEAEDSA-N. The full InChI is InChI=1S/C15H19NO5/c17-8-10-6-11(14(20)15(21)13(10)19)16-7-12(18)9-4-2-1-3-5-9/h1-7,11-15,17-21H,8H2/b16-7+.
What are the key properties of 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol?
4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol has a molecular weight of 293.32 g/mol, XLogP of -0.83, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-6-[(2-hydroxy-2-phenylethylidene)amino]cyclohex-4-ene-1,2,3-triol is sourced from PubChem (CID 21021600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).