About 7-methylspiro[2.5]octane
7-methylspiro[2.5]octane (PubChem CID 21021869) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is 7-methylspiro[2.5]octane.
Molecular Properties
| Compound Name | 7-methylspiro[2.5]octane |
| PubChem CID | 21021869 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 7-methylspiro[2.5]octane |
| SMILES | CC1CCCC2(CC2)C1 |
| InChI | InChI=1S/C9H16/c1-8-3-2-4-9(7-8)5-6-9/h8H,2-7H2,1H3 |
| InChIKey | VKZYYOJPSOQYDQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-methylspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylspiro[2.5]octane?
The IUPAC name of 7-methylspiro[2.5]octane (CID 21021869) is 7-methylspiro[2.5]octane.
What is the SMILES notation for 7-methylspiro[2.5]octane?
The canonical SMILES for 7-methylspiro[2.5]octane is CC1CCCC2(CC2)C1.
What is the InChIKey of 7-methylspiro[2.5]octane?
The InChIKey is VKZYYOJPSOQYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16/c1-8-3-2-4-9(7-8)5-6-9/h8H,2-7H2,1H3.
What are the key properties of 7-methylspiro[2.5]octane?
7-methylspiro[2.5]octane has a molecular weight of 124.23 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylspiro[2.5]octane is sourced from PubChem (CID 21021869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).