C20H27F3O — CID 21022470
5-propyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]oxane (PubChem CID 21022470) has the molecular formula C20H27F3O and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-propyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]oxane.
| Compound Name | 5-propyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 21022470 |
| Molecular Formula | C20H27F3O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 5-propyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]oxane |
| SMILES | CCCC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C20H27F3O/c1-2-3-13-4-9-19(24-12-13)15-7-5-14(6-8-15)16-10-17(21)20(23)18(22)11-16/h10-11,13-15,19H,2-9,12H2,1H3 |
| InChIKey | JIDMVMUKWQXAEW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|