C21H26N8O — CID 21022626
2-N-[3-[4-[(4-methoxyphenyl)diazenyl]-N-methylanilino]propyl]-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 21022626) has the molecular formula C21H26N8O and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-N-[3-[4-[(4-methoxyphenyl)diazenyl]-N-methylanilino]propyl]-6-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[3-[4-[(4-methoxyphenyl)diazenyl]-N-methylanilino]propyl]-6-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21022626 |
| Molecular Formula | C21H26N8O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-N-[3-[4-[(4-methoxyphenyl)diazenyl]-N-methylanilino]propyl]-6-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(/N=N/c2ccc(N(C)CCCNc3nc(C)nc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C21H26N8O/c1-15-24-20(22)26-21(25-15)23-13-4-14-29(2)18-9-5-16(6-10-18)27-28-17-7-11-19(30-3)12-8-17/h5-12H,4,13-14H2,1-3H3,(H3,22,23,24,25,26)/b28-27+ |
| InChIKey | BRVCCSXDEZASHP-BYYHNAKLSA-N |
| XLogP | 4.12 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|