About 5-methyl-4a,5,8,8a-tetrahydrophthalazine
5-methyl-4a,5,8,8a-tetrahydrophthalazine (PubChem CID 21022820) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-methyl-4a,5,8,8a-tetrahydrophthalazine.
Molecular Properties
| Compound Name | 5-methyl-4a,5,8,8a-tetrahydrophthalazine |
| PubChem CID | 21022820 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5-methyl-4a,5,8,8a-tetrahydrophthalazine |
| SMILES | CC1C=CCC2C=NN=CC12 |
| InChI | InChI=1S/C9H12N2/c1-7-3-2-4-8-5-10-11-6-9(7)8/h2-3,5-9H,4H2,1H3 |
| InChIKey | AESJOTNXNJVDOK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4a,5,8,8a-tetrahydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4a,5,8,8a-tetrahydrophthalazine?
The IUPAC name of 5-methyl-4a,5,8,8a-tetrahydrophthalazine (CID 21022820) is 5-methyl-4a,5,8,8a-tetrahydrophthalazine.
What is the SMILES notation for 5-methyl-4a,5,8,8a-tetrahydrophthalazine?
The canonical SMILES for 5-methyl-4a,5,8,8a-tetrahydrophthalazine is CC1C=CCC2C=NN=CC12.
What is the InChIKey of 5-methyl-4a,5,8,8a-tetrahydrophthalazine?
The InChIKey is AESJOTNXNJVDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-3-2-4-8-5-10-11-6-9(7)8/h2-3,5-9H,4H2,1H3.
What are the key properties of 5-methyl-4a,5,8,8a-tetrahydrophthalazine?
5-methyl-4a,5,8,8a-tetrahydrophthalazine has a molecular weight of 148.21 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4a,5,8,8a-tetrahydrophthalazine is sourced from PubChem (CID 21022820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).