C30H28 — CID 21023110
8,9,12,13,17,18,21,22-octamethylheptacyclo[12.4.2.22,5.03,10.04,7.011,19.016,20]docosa-1(18),2(22),3(10),4(7),5(21),8,11(19),12,14(20),16-decaene (PubChem CID 21023110) has the molecular formula C30H28 and a molecular weight of 388.55 g/mol. Its IUPAC name is 8,9,12,13,17,18,21,22-octamethylheptacyclo[12.4.2.22,5.03,10.04,7.011,19.016,20]docosa-1(18),2(22),3(10),4(7),5(21),8,11(19),12,14(20),16-decaene.
| Compound Name | 8,9,12,13,17,18,21,22-octamethylheptacyclo[12.4.2.22,5.03,10.04,7.011,19.016,20]docosa-1(18),2(22),3(10),4(7),5(21),8,11(19),12,14(20),16-decaene |
|---|---|
| PubChem CID | 21023110 |
| Molecular Formula | C30H28 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 8,9,12,13,17,18,21,22-octamethylheptacyclo[12.4.2.22,5.03,10.04,7.011,19.016,20]docosa-1(18),2(22),3(10),4(7),5(21),8,11(19),12,14(20),16-decaene |
| SMILES | Cc1c2c3c(c(C)c(C)c4c5c(C)c(C)c6c7c(c(C)c(C)c(c(c1C)c34)c75)C6)C2 |
| InChI | InChI=1S/C30H28/c1-11-15(5)23-24-16(6)13(3)21-10-22-14(4)18(8)26(30(24)28(21)22)25-17(7)12(2)20-9-19(11)27(20)29(23)25/h9-10H2,1-8H3 |
| InChIKey | IKEGZSUBFLWQQO-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|