C36H64O7Si — CID 21023940
(9E)-12-[(2E,4E)-7-[3-[3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-hydroxy-7,8-dimethoxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 21023940) has the molecular formula C36H64O7Si and a molecular weight of 636.99 g/mol. Its IUPAC name is (9E)-12-[(2E,4E)-7-[3-[3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-hydroxy-7,8-dimethoxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-12-[(2E,4E)-7-[3-[3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-hydroxy-7,8-dimethoxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 21023940 |
| Molecular Formula | C36H64O7Si |
| Molecular Weight | 636.99 g/mol |
| Exact Mass | 636.44 |
| IUPAC Name | (9E)-12-[(2E,4E)-7-[3-[3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-hydroxy-7,8-dimethoxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(O[Si](C)(C)C(C)(C)C)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(OC)C(OC)/C=C/C1C |
| InChI | InChI=1S/C36H64O7Si/c1-14-29(43-44(12,13)35(6,7)8)27(5)34-30(41-34)22-24(2)16-15-17-25(3)33-26(4)18-19-31(39-10)36(9,40-11)21-20-28(37)23-32(38)42-33/h15-19,24,26-31,33-34,37H,14,20-23H2,1-13H3/b16-15+,19-18+,25-17+ |
| InChIKey | NNEDJXHEBZAJCV-WQWUGHEISA-N |
| XLogP | 7.79 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.99 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|