C40H70O10 — CID 21023947
(9E)-4,7-bis(1-ethoxyethoxy)-12-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-8-hydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 21023947) has the molecular formula C40H70O10 and a molecular weight of 710.99 g/mol. Its IUPAC name is (9E)-4,7-bis(1-ethoxyethoxy)-12-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-8-hydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-4,7-bis(1-ethoxyethoxy)-12-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-8-hydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 21023947 |
| Molecular Formula | C40H70O10 |
| Molecular Weight | 710.99 g/mol |
| Exact Mass | 710.50 |
| IUPAC Name | (9E)-4,7-bis(1-ethoxyethoxy)-12-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-8-hydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCOC(C)OC1CCC(C)(OC(C)OCC)C(O)/C=C/C(C)C(/C(C)=C/C=C/C(C)CC2OC2C(C)C(CC)OC(C)OCC)OC(=O)C1 |
| InChI | InChI=1S/C40H70O10/c1-13-34(47-31(10)44-15-3)29(8)39-35(48-39)24-26(5)18-17-19-27(6)38-28(7)20-21-36(41)40(12,50-32(11)45-16-4)23-22-33(25-37(42)49-38)46-30(9)43-14-2/h17-21,26,28-36,38-39,41H,13-16,22-25H2,1-12H3/b18-17+,21-20+,27-19+ |
| InChIKey | NOSSOUCSSDMZET-OHRYUNQISA-N |
| XLogP | 7.67 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.99 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|