C32H51ClO9 — CID 21023975
[(4E)-2-[(2E,4E)-9-acetyloxy-8-chloro-11-hydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 21023975) has the molecular formula C32H51ClO9 and a molecular weight of 615.20 g/mol. Its IUPAC name is [(4E)-2-[(2E,4E)-9-acetyloxy-8-chloro-11-hydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-2-[(2E,4E)-9-acetyloxy-8-chloro-11-hydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 21023975 |
| Molecular Formula | C32H51ClO9 |
| Molecular Weight | 615.20 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | [(4E)-2-[(2E,4E)-9-acetyloxy-8-chloro-11-hydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(O)C(C)C(OC(C)=O)C(Cl)CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C32H51ClO9/c1-9-27(37)22(5)31(41-24(7)35)26(33)17-19(2)11-10-12-20(3)30-21(4)13-14-28(40-23(6)34)32(8,39)16-15-25(36)18-29(38)42-30/h10-14,19,21-22,25-28,30-31,36-37,39H,9,15-18H2,1-8H3/b11-10+,14-13+,20-12+ |
| InChIKey | FBDPGGUWWAZDQE-HKEPWWEDSA-N |
| XLogP | 4.79 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|