C36H58N2O9 — CID 21023998
[(9E)-8-acetyloxy-7-hydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 21023998) has the molecular formula C36H58N2O9 and a molecular weight of 662.86 g/mol. Its IUPAC name is [(9E)-8-acetyloxy-7-hydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [(9E)-8-acetyloxy-7-hydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 21023998 |
| Molecular Formula | C36H58N2O9 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | [(9E)-8-acetyloxy-7-hydroxy-12-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | CCC(O)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(OC(=O)N2CCN(C)CC2)CCC(C)(O)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C36H58N2O9/c1-9-29(40)26(5)34-30(46-34)21-23(2)11-10-12-24(3)33-25(4)13-14-31(44-27(6)39)36(7,43)16-15-28(22-32(41)47-33)45-35(42)38-19-17-37(8)18-20-38/h10-14,23,25-26,28-31,33-34,40,43H,9,15-22H2,1-8H3/b11-10+,14-13+,24-12+ |
| InChIKey | USVKWSYKUIYXEG-GSATYDODSA-N |
| XLogP | 4.41 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|