C8H12 — CID 21024
2,5-dimethylhexa-1,3,5-triene (PubChem CID 21024) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is 2,5-dimethylhexa-1,3,5-triene.
| Compound Name | 2,5-dimethylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 21024 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 2,5-dimethylhexa-1,3,5-triene |
| SMILES | C=C(C)C=CC(=C)C |
| InChI | InChI=1S/C8H12/c1-7(2)5-6-8(3)4/h5-6H,1,3H2,2,4H3 |
| InChIKey | ZVFFWOKVVPSTAL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|