C42H72O11 — CID 21024001
[(4E)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 21024001) has the molecular formula C42H72O11 and a molecular weight of 753.03 g/mol. Its IUPAC name is [(4E)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 21024001 |
| Molecular Formula | C42H72O11 |
| Molecular Weight | 753.03 g/mol |
| Exact Mass | 752.51 |
| IUPAC Name | [(4E)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCOC(C)OC1CCC(C)(OC(C)OCC)C(OC(C)=O)/C=C/C(C)C(/C(C)=C/C=C/C(C)CC2OC2C(C)C(CC)OC(C)OCC)OC(=O)C1 |
| InChI | InChI=1S/C42H72O11/c1-14-36(50-33(11)46-16-3)30(8)41-37(51-41)25-27(5)19-18-20-28(6)40-29(7)21-22-38(48-31(9)43)42(13,53-34(12)47-17-4)24-23-35(26-39(44)52-40)49-32(10)45-15-2/h18-22,27,29-30,32-38,40-41H,14-17,23-26H2,1-13H3/b19-18+,22-21+,28-20+ |
| InChIKey | ASPIPRDNPTXMRB-BINXUUFGSA-N |
| XLogP | 8.24 |
| TPSA | 120.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.03 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|