C31H48ClNO9 — CID 21024039
[(4E)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-chloroacetyl)carbamate (PubChem CID 21024039) has the molecular formula C31H48ClNO9 and a molecular weight of 614.18 g/mol. Its IUPAC name is [(4E)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-chloroacetyl)carbamate.
| Compound Name | [(4E)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-chloroacetyl)carbamate |
|---|---|
| PubChem CID | 21024039 |
| Molecular Formula | C31H48ClNO9 |
| Molecular Weight | 614.18 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | [(4E)-7,10-dihydroxy-2-[(2E,4E)-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(2-chloroacetyl)carbamate |
| SMILES | CCC(O)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=O)NC(=O)CCl)/C=C/C1C |
| InChI | InChI=1S/C31H48ClNO9/c1-7-23(35)21(5)29-24(40-29)15-18(2)9-8-10-19(3)28-20(4)11-12-25(41-30(38)33-26(36)17-32)31(6,39)14-13-22(34)16-27(37)42-28/h8-12,18,20-25,28-29,34-35,39H,7,13-17H2,1-6H3,(H,33,36,38)/b9-8+,12-11+,19-10+ |
| InChIKey | PLDRYNPXBYNERH-VEIZMLQLSA-N |
| XLogP | 3.95 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|