About 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide
2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide (PubChem CID 21024386) has the molecular formula C21H19F2NO3
and a molecular weight of 371.38 g/mol. Its IUPAC name is 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide |
| PubChem CID | 21024386 |
| Molecular Formula | C21H19F2NO3 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2cc(C(F)(F)C(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C21H19F2NO3/c1-13-16-10-9-15(21(22,23)20(26)24(2)3)12-18(16)27-19(25)17(13)11-14-7-5-4-6-8-14/h4-10,12H,11H2,1-3H3 |
| InChIKey | RCCDDIDMRAFVFD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide?
The IUPAC name of 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide (CID 21024386) is 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide.
What is the SMILES notation for 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide?
The canonical SMILES for 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide is Cc1c(Cc2ccccc2)c(=O)oc2cc(C(F)(F)C(=O)N(C)C)ccc12.
What is the InChIKey of 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide?
The InChIKey is RCCDDIDMRAFVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2NO3/c1-13-16-10-9-15(21(22,23)20(26)24(2)3)12-18(16)27-19(25)17(13)11-14-7-5-4-6-8-14/h4-10,12H,11H2,1-3H3.
What are the key properties of 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide?
2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide has a molecular weight of 371.38 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzyl-4-methyl-2-oxochromen-7-yl)-2,2-difluoro-N,N-dimethylacetamide is sourced from PubChem (CID 21024386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).