About benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine
benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (PubChem CID 21024834) has the molecular formula C22H16N2PtS
and a molecular weight of 535.53 g/mol. Its IUPAC name is benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
Molecular Properties
| Compound Name | benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| PubChem CID | 21024834 |
| Molecular Formula | C22H16N2PtS |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| SMILES | [Pt+2].[S-]c1ccccc1.[c-]1c(-c2ccccn2)cccc1-c1ccccn1 |
| InChI | InChI=1S/C16H11N2.C6H6S.Pt/c1-3-10-17-15(8-1)13-6-5-7-14(12-13)16-9-2-4-11-18-16;7-6-4-2-1-3-5-6;/h1-11H;1-5,7H;/q-1;;+2/p-1 |
| InChIKey | VFCBAYSZFFSGIE-UHFFFAOYSA-M |
| XLogP | 5.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
The IUPAC name of benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (CID 21024834) is benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
What is the SMILES notation for benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
The canonical SMILES for benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine is [Pt+2].[S-]c1ccccc1.[c-]1c(-c2ccccn2)cccc1-c1ccccn1.
What is the InChIKey of benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
The InChIKey is VFCBAYSZFFSGIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H11N2.C6H6S.Pt/c1-3-10-17-15(8-1)13-6-5-7-14(12-13)16-9-2-4-11-18-16;7-6-4-2-1-3-5-6;/h1-11H;1-5,7H;/q-1;;+2/p-1.
What are the key properties of benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine has a molecular weight of 535.53 g/mol, XLogP of 5.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiolate;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine is sourced from PubChem (CID 21024834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).