C26H18F4N2Pt — CID 21024849
fluoroplatinum(1+);1-[3-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]benzene-6-id-1-yl]-N,1-diphenylmethanimine (PubChem CID 21024849) has the molecular formula C26H18F4N2Pt and a molecular weight of 629.51 g/mol. Its IUPAC name is fluoroplatinum(1+);1-[3-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]benzene-6-id-1-yl]-N,1-diphenylmethanimine.
| Compound Name | fluoroplatinum(1+);1-[3-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]benzene-6-id-1-yl]-N,1-diphenylmethanimine |
|---|---|
| PubChem CID | 21024849 |
| Molecular Formula | C26H18F4N2Pt |
| Molecular Weight | 629.51 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | fluoroplatinum(1+);1-[3-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]benzene-6-id-1-yl]-N,1-diphenylmethanimine |
| SMILES | Cc1cc(/C(=N/c2ccccc2)c2ccccc2)[c-]c(-c2cc(C(F)(F)F)ccn2)c1.F[Pt+] |
| InChI | InChI=1S/C26H18F3N2.FH.Pt/c1-18-14-20(24-17-22(12-13-30-24)26(27,28)29)16-21(15-18)25(19-8-4-2-5-9-19)31-23-10-6-3-7-11-23;;/h2-15,17H,1H3;1H;/q-1;;+2/p-1/b31-25+;; |
| InChIKey | IWVRYYTZJQNRDH-ARXDYCJMSA-M |
| XLogP | 7.46 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.51 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|