C27H24N7O2+ — CID 21025171
N-[3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl]-1,5-dimethyl-3H-pyrazol-1-ium-3-carboxamide (PubChem CID 21025171) has the molecular formula C27H24N7O2+ and a molecular weight of 478.54 g/mol. Its IUPAC name is N-[3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl]-1,5-dimethyl-3H-pyrazol-1-ium-3-carboxamide.
| Compound Name | N-[3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl]-1,5-dimethyl-3H-pyrazol-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 21025171 |
| Molecular Formula | C27H24N7O2+ |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[3-cyano-5-methyl-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazin-6-yl]-1,5-dimethyl-3H-pyrazol-1-ium-3-carboxamide |
| SMILES | CC1=CC(C(=O)Nc2cn3ncc(C#N)c(Nc4ccc(Oc5ccccc5)cc4)c3c2C)N=[N+]1C |
| InChI | InChI=1S/C27H23N7O2/c1-17-13-23(32-33(17)3)27(35)31-24-16-34-26(18(24)2)25(19(14-28)15-29-34)30-20-9-11-22(12-10-20)36-21-7-5-4-6-8-21/h4-13,15-16,23H,1-3H3,(H-,29,30,31,35)/p+1 |
| InChIKey | ZUUPGSKYRXGMSG-UHFFFAOYSA-O |
| XLogP | 5.37 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|