C28H31Cl2N5O4S2 — CID 21025184
1-[6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-3-(4,5-dichloro-2-nitrophenyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]thiourea (PubChem CID 21025184) has the molecular formula C28H31Cl2N5O4S2 and a molecular weight of 636.63 g/mol. Its IUPAC name is 1-[6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-3-(4,5-dichloro-2-nitrophenyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]thiourea.
| Compound Name | 1-[6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-3-(4,5-dichloro-2-nitrophenyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 21025184 |
| Molecular Formula | C28H31Cl2N5O4S2 |
| Molecular Weight | 636.63 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 1-[6-(3-cyanophenyl)-3-bicyclo[4.1.0]heptanyl]-3-(4,5-dichloro-2-nitrophenyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]thiourea |
| SMILES | CS(=O)(=O)N1CCC(CN(C(=S)Nc2cc(Cl)c(Cl)cc2[N+](=O)[O-])C2CCC3(c4cccc(C#N)c4)CC3C2)CC1 |
| InChI | InChI=1S/C28H31Cl2N5O4S2/c1-41(38,39)33-9-6-18(7-10-33)17-34(27(40)32-25-13-23(29)24(30)14-26(25)35(36)37)22-5-8-28(15-21(28)12-22)20-4-2-3-19(11-20)16-31/h2-4,11,13-14,18,21-22H,5-10,12,15,17H2,1H3,(H,32,40) |
| InChIKey | GHEOLRXWNSZMJG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|