C12H23N — CID 21025349
1,4-di(propan-2-yl)-2,3,6,7-tetrahydroazepine (PubChem CID 21025349) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)-2,3,6,7-tetrahydroazepine.
| Compound Name | 1,4-di(propan-2-yl)-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 21025349 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1,4-di(propan-2-yl)-2,3,6,7-tetrahydroazepine |
| SMILES | CC(C)C1=CCCN(C(C)C)CC1 |
| InChI | InChI=1S/C12H23N/c1-10(2)12-6-5-8-13(9-7-12)11(3)4/h6,10-11H,5,7-9H2,1-4H3 |
| InChIKey | VXLMXFKLKDMKAA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|