C21H21N3O3 — CID 2102546
4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 2102546) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2102546 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(=O)[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-27-16-8-6-15(7-9-16)23-10-12-24(13-11-23)21(26)18-14-20(25)22-19-5-3-2-4-17(18)19/h2-9,14H,10-13H2,1H3,(H,22,25) |
| InChIKey | HWQXSFIHOFYVQC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|