About N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide
N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide (PubChem CID 21025637) has the molecular formula C21H39NO
and a molecular weight of 321.55 g/mol. Its IUPAC name is N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide |
| PubChem CID | 21025637 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide |
| SMILES | CC(C)C1CCC(N(C(=O)CC(C)(C)C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H39NO/c1-16(2)17-11-13-19(14-12-17)22(18-9-7-6-8-10-18)20(23)15-21(3,4)5/h16-19H,6-15H2,1-5H3 |
| InChIKey | NQWKYSLMHSRIEQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide?
The IUPAC name of N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide (CID 21025637) is N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide.
What is the SMILES notation for N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide?
The canonical SMILES for N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide is CC(C)C1CCC(N(C(=O)CC(C)(C)C)C2CCCCC2)CC1.
What is the InChIKey of N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide?
The InChIKey is NQWKYSLMHSRIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39NO/c1-16(2)17-11-13-19(14-12-17)22(18-9-7-6-8-10-18)20(23)15-21(3,4)5/h16-19H,6-15H2,1-5H3.
What are the key properties of N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide?
N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide has a molecular weight of 321.55 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3,3-dimethyl-N-(4-propan-2-ylcyclohexyl)butanamide is sourced from PubChem (CID 21025637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).