About 4-fluoro-1,2,2-trimethylpyrrolidine
4-fluoro-1,2,2-trimethylpyrrolidine (PubChem CID 21025965) has the molecular formula C7H14FN
and a molecular weight of 131.19 g/mol. Its IUPAC name is 4-fluoro-1,2,2-trimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-fluoro-1,2,2-trimethylpyrrolidine |
| PubChem CID | 21025965 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 4-fluoro-1,2,2-trimethylpyrrolidine |
| SMILES | CN1CC(F)CC1(C)C |
| InChI | InChI=1S/C7H14FN/c1-7(2)4-6(8)5-9(7)3/h6H,4-5H2,1-3H3 |
| InChIKey | TWVBVMNMWMYQNC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-1,2,2-trimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2,2-trimethylpyrrolidine?
The IUPAC name of 4-fluoro-1,2,2-trimethylpyrrolidine (CID 21025965) is 4-fluoro-1,2,2-trimethylpyrrolidine.
What is the SMILES notation for 4-fluoro-1,2,2-trimethylpyrrolidine?
The canonical SMILES for 4-fluoro-1,2,2-trimethylpyrrolidine is CN1CC(F)CC1(C)C.
What is the InChIKey of 4-fluoro-1,2,2-trimethylpyrrolidine?
The InChIKey is TWVBVMNMWMYQNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FN/c1-7(2)4-6(8)5-9(7)3/h6H,4-5H2,1-3H3.
What are the key properties of 4-fluoro-1,2,2-trimethylpyrrolidine?
4-fluoro-1,2,2-trimethylpyrrolidine has a molecular weight of 131.19 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2,2-trimethylpyrrolidine is sourced from PubChem (CID 21025965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).