C24H23FN4O4S — CID 21025981
2-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-1-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 21025981) has the molecular formula C24H23FN4O4S and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-1-N-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-1-N-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21025981 |
| Molecular Formula | C24H23FN4O4S |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-N-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)C2CCCN2C(=O)Nc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H23FN4O4S/c25-19-15-16(18-9-4-5-11-22(18)34(26,32)33)12-13-20(19)28-23(30)21-10-6-14-29(21)24(31)27-17-7-2-1-3-8-17/h1-5,7-9,11-13,15,21H,6,10,14H2,(H,27,31)(H,28,30)(H2,26,32,33) |
| InChIKey | OBQZKTHLYMINJK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |