C17H31NO4 — CID 21026384
(3,3,8,8,10,10,11-heptamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate (PubChem CID 21026384) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3,3,8,8,10,10,11-heptamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate.
| Compound Name | (3,3,8,8,10,10,11-heptamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate |
|---|---|
| PubChem CID | 21026384 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (3,3,8,8,10,10,11-heptamethyl-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl) acetate |
| SMILES | CC(=O)ON1C(C)(C)CC2(OCC(C)(C)CO2)C(C)C1(C)C |
| InChI | InChI=1S/C17H31NO4/c1-12-16(7,8)18(22-13(2)19)15(5,6)9-17(12)20-10-14(3,4)11-21-17/h12H,9-11H2,1-8H3 |
| InChIKey | KUEBPWRYMWZPBF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |