C38H39NO6 — CID 21026389
(9-acetyloxy-3,8,10-triethyl-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate (PubChem CID 21026389) has the molecular formula C38H39NO6 and a molecular weight of 605.73 g/mol. Its IUPAC name is (9-acetyloxy-3,8,10-triethyl-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate.
| Compound Name | (9-acetyloxy-3,8,10-triethyl-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate |
|---|---|
| PubChem CID | 21026389 |
| Molecular Formula | C38H39NO6 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | (9-acetyloxy-3,8,10-triethyl-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC(=O)OCC1(CC)COC2(CC(C)(CC)N(OC(C)=O)C(C)(CC)C2C)OC1 |
| InChI | InChI=1S/C38H39NO6/c1-9-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-34(41)42-29-37(12-4)30-43-38(44-31-37)28-35(7,10-2)39(45-33(6)40)36(8,11-3)32(38)5/h32H,10-12,28-31H2,1-8H3 |
| InChIKey | BKVVINRGIRANDP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|