C14H18F14N2 — CID 21026478
N'-butan-2-yl-N,N'-bis(1,1,2,2,3,3,4-heptafluorobutyl)ethane-1,2-diamine (PubChem CID 21026478) has the molecular formula C14H18F14N2 and a molecular weight of 480.28 g/mol. Its IUPAC name is N'-butan-2-yl-N,N'-bis(1,1,2,2,3,3,4-heptafluorobutyl)ethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N,N'-bis(1,1,2,2,3,3,4-heptafluorobutyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 21026478 |
| Molecular Formula | C14H18F14N2 |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N'-butan-2-yl-N,N'-bis(1,1,2,2,3,3,4-heptafluorobutyl)ethane-1,2-diamine |
| SMILES | CCC(C)N(CCNC(F)(F)C(F)(F)C(F)(F)CF)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C14H18F14N2/c1-3-8(2)30(14(27,28)12(23,24)10(19,20)7-16)5-4-29-13(25,26)11(21,22)9(17,18)6-15/h8,29H,3-7H2,1-2H3 |
| InChIKey | QDUNPTMRYRZHOI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|