About (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile
(2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile (PubChem CID 21026564) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile.
Molecular Properties
| Compound Name | (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile |
| PubChem CID | 21026564 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile |
| SMILES | C=CCC(C)(C)[C@H](C#N)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H22N2/c1-5-11-16(3,4)15(12-17)18-13(2)14-9-7-6-8-10-14/h5-10,13,15,18H,1,11H2,2-4H3/t13-,15+/m1/s1 |
| InChIKey | LWHGKZLTEZOZKY-HIFRSBDPSA-N |
| XLogP | 3.83 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile?
The IUPAC name of (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile (CID 21026564) is (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile.
What is the SMILES notation for (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile?
The canonical SMILES for (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile is C=CCC(C)(C)[C@H](C#N)N[C@H](C)c1ccccc1.
What is the InChIKey of (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile?
The InChIKey is LWHGKZLTEZOZKY-HIFRSBDPSA-N. The full InChI is InChI=1S/C16H22N2/c1-5-11-16(3,4)15(12-17)18-13(2)14-9-7-6-8-10-14/h5-10,13,15,18H,1,11H2,2-4H3/t13-,15+/m1/s1.
What are the key properties of (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile?
(2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile has a molecular weight of 242.37 g/mol, XLogP of 3.83, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-dimethyl-2-[[(1R)-1-phenylethyl]amino]hex-5-enenitrile is sourced from PubChem (CID 21026564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).