C30H55N7O2-2 — CID 21026684
N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-methyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexane-1,6-diamine (PubChem CID 21026684) has the molecular formula C30H55N7O2-2 and a molecular weight of 545.82 g/mol. Its IUPAC name is N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-methyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-methyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 21026684 |
| Molecular Formula | C30H55N7O2-2 |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 545.44 |
| IUPAC Name | N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-methyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexane-1,6-diamine |
| SMILES | Cc1nc(C)nc(N(CCCCCCN(C)C2CC(C)(C)N([O-])C(C)(C)C2)C2CC(C)(C)N([O-])C(C)(C)C2)n1 |
| InChI | InChI=1S/C30H55N7O2/c1-22-31-23(2)33-26(32-22)35(25-20-29(7,8)37(39)30(9,10)21-25)17-15-13-12-14-16-34(11)24-18-27(3,4)36(38)28(5,6)19-24/h24-25H,12-21H2,1-11H3/q-2 |
| InChIKey | OLHARIOPAVGRBY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|