C18H26O4 — CID 21026948
2-[4-(2-ethenoxyethoxy)phenyl]-4,6-diethyl-1,3-dioxane (PubChem CID 21026948) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[4-(2-ethenoxyethoxy)phenyl]-4,6-diethyl-1,3-dioxane.
| Compound Name | 2-[4-(2-ethenoxyethoxy)phenyl]-4,6-diethyl-1,3-dioxane |
|---|---|
| PubChem CID | 21026948 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[4-(2-ethenoxyethoxy)phenyl]-4,6-diethyl-1,3-dioxane |
| SMILES | C=COCCOc1ccc(C2OC(CC)CC(CC)O2)cc1 |
| InChI | InChI=1S/C18H26O4/c1-4-15-13-16(5-2)22-18(21-15)14-7-9-17(10-8-14)20-12-11-19-6-3/h6-10,15-16,18H,3-5,11-13H2,1-2H3 |
| InChIKey | ZZKDZTLWOWBOBB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|