About N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide
N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide (PubChem CID 21027172) has the molecular formula C11H22N2O4
and a molecular weight of 246.31 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide.
Molecular Properties
| Compound Name | N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide |
| PubChem CID | 21027172 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide |
| SMILES | CC(C)(C)NC(=O)CCC(=O)NCC(O)CO |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,3)13-10(17)5-4-9(16)12-6-8(15)7-14/h8,14-15H,4-7H2,1-3H3,(H,12,16)(H,13,17) |
| InChIKey | NZABJSXVYALUAL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide?
The IUPAC name of N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide (CID 21027172) is N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide.
What is the SMILES notation for N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide?
The canonical SMILES for N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide is CC(C)(C)NC(=O)CCC(=O)NCC(O)CO.
What is the InChIKey of N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide?
The InChIKey is NZABJSXVYALUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4/c1-11(2,3)13-10(17)5-4-9(16)12-6-8(15)7-14/h8,14-15H,4-7H2,1-3H3,(H,12,16)(H,13,17).
What are the key properties of N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide?
N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide has a molecular weight of 246.31 g/mol, XLogP of -0.85, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-N-(2,3-dihydroxypropyl)butanediamide is sourced from PubChem (CID 21027172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).