About 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine
2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine (PubChem CID 21027222) has the molecular formula C6H15N5
and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine |
| PubChem CID | 21027222 |
| Molecular Formula | C6H15N5 |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine |
| SMILES | CC/N=C(N)/N=C(/N)N(C)C |
| InChI | InChI=1S/C6H15N5/c1-4-9-5(7)10-6(8)11(2)3/h4H2,1-3H3,(H4,7,8,9,10) |
| InChIKey | LJKFXHRTWMQIKM-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine?
The IUPAC name of 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine (CID 21027222) is 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine.
What is the SMILES notation for 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine?
The canonical SMILES for 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine is CC/N=C(N)/N=C(/N)N(C)C.
What is the InChIKey of 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine?
The InChIKey is LJKFXHRTWMQIKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N5/c1-4-9-5(7)10-6(8)11(2)3/h4H2,1-3H3,(H4,7,8,9,10).
What are the key properties of 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine?
2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine has a molecular weight of 157.22 g/mol, XLogP of -0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-ethylcarbamimidoyl)-1,1-dimethylguanidine is sourced from PubChem (CID 21027222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).