C9H19N5 — CID 21027249
2-N,2-N,6-N,6-N,4,4-hexamethyl-1H-1,3,5-triazine-2,6-diamine (PubChem CID 21027249) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N,4,4-hexamethyl-1H-1,3,5-triazine-2,6-diamine.
| Compound Name | 2-N,2-N,6-N,6-N,4,4-hexamethyl-1H-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 21027249 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 2-N,2-N,6-N,6-N,4,4-hexamethyl-1H-1,3,5-triazine-2,6-diamine |
| SMILES | CN(C)C1=NC(C)(C)N=C(N(C)C)N1 |
| InChI | InChI=1S/C9H19N5/c1-9(2)11-7(13(3)4)10-8(12-9)14(5)6/h1-6H3,(H,10,11,12) |
| InChIKey | DPQKEBGADYLGMV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |