C25H14F3N3O — CID 21027393
(4-fluorophenyl)-[2-(4-fluorophenyl)-3-(2-fluoro-4-pyridinyl)pyrazolo[1,5-a]pyridin-7-yl]methanone (PubChem CID 21027393) has the molecular formula C25H14F3N3O and a molecular weight of 429.40 g/mol. Its IUPAC name is (4-fluorophenyl)-[2-(4-fluorophenyl)-3-(2-fluoro-4-pyridinyl)pyrazolo[1,5-a]pyridin-7-yl]methanone.
| Compound Name | (4-fluorophenyl)-[2-(4-fluorophenyl)-3-(2-fluoro-4-pyridinyl)pyrazolo[1,5-a]pyridin-7-yl]methanone |
|---|---|
| PubChem CID | 21027393 |
| Molecular Formula | C25H14F3N3O |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (4-fluorophenyl)-[2-(4-fluorophenyl)-3-(2-fluoro-4-pyridinyl)pyrazolo[1,5-a]pyridin-7-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)c1cccc2c(-c3ccnc(F)c3)c(-c3ccc(F)cc3)nn12 |
| InChI | InChI=1S/C25H14F3N3O/c26-18-8-4-15(5-9-18)24-23(17-12-13-29-22(28)14-17)20-2-1-3-21(31(20)30-24)25(32)16-6-10-19(27)11-7-16/h1-14H |
| InChIKey | XIJWUGBJVTWFPG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|