C9H19NO2 — CID 21027684
4-[ethyl(propan-2-yl)amino]butanoic acid (PubChem CID 21027684) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-[ethyl(propan-2-yl)amino]butanoic acid.
| Compound Name | 4-[ethyl(propan-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 21027684 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-[ethyl(propan-2-yl)amino]butanoic acid |
| SMILES | CCN(CCCC(=O)O)C(C)C |
| InChI | InChI=1S/C9H19NO2/c1-4-10(8(2)3)7-5-6-9(11)12/h8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | ZFCHHTDNCYXPFV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |