C23H31NO6 — CID 21027754
[(E)-3-(2,5-dimethoxyphenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 21027754) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is [(E)-3-(2,5-dimethoxyphenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | [(E)-3-(2,5-dimethoxyphenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 21027754 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [(E)-3-(2,5-dimethoxyphenyl)prop-2-enyl] 1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)OC/C=C/c1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H31NO6/c1-6-23(2,3)20(25)21(26)24-13-7-10-18(24)22(27)30-14-8-9-16-15-17(28-4)11-12-19(16)29-5/h8-9,11-12,15,18H,6-7,10,13-14H2,1-5H3/b9-8+ |
| InChIKey | MBHXFSQKWOYBQR-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|