About 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate
2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate (PubChem CID 21027976) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate |
| PubChem CID | 21027976 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CC(=O)CC |
| InChI | InChI=1S/C11H16O5/c1-4-9(12)7-10(13)15-5-6-16-11(14)8(2)3/h2,4-7H2,1,3H3 |
| InChIKey | IAFHQUUEANCLIS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate (CID 21027976) is 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate is C=C(C)C(=O)OCCOC(=O)CC(=O)CC.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate?
The InChIKey is IAFHQUUEANCLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-4-9(12)7-10(13)15-5-6-16-11(14)8(2)3/h2,4-7H2,1,3H3.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate?
2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate has a molecular weight of 228.24 g/mol, XLogP of 1.02, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 3-oxopentanoate is sourced from PubChem (CID 21027976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).