C22H28N2O2 — CID 21028195
4-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 21028195) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 21028195 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=NN=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C(C)C1=O |
| InChI | InChI=1S/C22H28N2O2/c1-13-9-15(10-14(2)19(13)25)23-24-16-11-17(21(3,4)5)20(26)18(12-16)22(6,7)8/h9-12H,1-8H3 |
| InChIKey | XNRJCGJOVVAUEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|