About 1,4-ditert-butyl-1,4-diazepane
1,4-ditert-butyl-1,4-diazepane (PubChem CID 21028230) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1,4-ditert-butyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1,4-ditert-butyl-1,4-diazepane |
| PubChem CID | 21028230 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1,4-ditert-butyl-1,4-diazepane |
| SMILES | CC(C)(C)N1CCCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H28N2/c1-12(2,3)14-8-7-9-15(11-10-14)13(4,5)6/h7-11H2,1-6H3 |
| InChIKey | GAHGOSRZYKHIQY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-ditert-butyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butyl-1,4-diazepane?
The IUPAC name of 1,4-ditert-butyl-1,4-diazepane (CID 21028230) is 1,4-ditert-butyl-1,4-diazepane.
What is the SMILES notation for 1,4-ditert-butyl-1,4-diazepane?
The canonical SMILES for 1,4-ditert-butyl-1,4-diazepane is CC(C)(C)N1CCCN(C(C)(C)C)CC1.
What is the InChIKey of 1,4-ditert-butyl-1,4-diazepane?
The InChIKey is GAHGOSRZYKHIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-12(2,3)14-8-7-9-15(11-10-14)13(4,5)6/h7-11H2,1-6H3.
What are the key properties of 1,4-ditert-butyl-1,4-diazepane?
1,4-ditert-butyl-1,4-diazepane has a molecular weight of 212.38 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butyl-1,4-diazepane is sourced from PubChem (CID 21028230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).