C26H19OY2- — CID 21028400
7-methyl-9-(2-phenylphenyl)-2H-fluoren-2-id-9-ol;bis(yttrium) (PubChem CID 21028400) has the molecular formula C26H19OY2- and a molecular weight of 525.25 g/mol. Its IUPAC name is 7-methyl-9-(2-phenylphenyl)-2H-fluoren-2-id-9-ol;bis(yttrium).
| Compound Name | 7-methyl-9-(2-phenylphenyl)-2H-fluoren-2-id-9-ol;bis(yttrium) |
|---|---|
| PubChem CID | 21028400 |
| Molecular Formula | C26H19OY2- |
| Molecular Weight | 525.25 g/mol |
| Exact Mass | 524.96 |
| IUPAC Name | 7-methyl-9-(2-phenylphenyl)-2H-fluoren-2-id-9-ol;bis(yttrium) |
| SMILES | Cc1ccc2c(c1)C(O)(c1ccccc1-c1ccccc1)c1c[c-]ccc1-2.[Y].[Y] |
| InChI | InChI=1S/C26H19O.2Y/c1-18-15-16-22-21-12-6-8-14-24(21)26(27,25(22)17-18)23-13-7-5-11-20(23)19-9-3-2-4-10-19;;/h2-7,9-17,27H,1H3;;/q-1;; |
| InChIKey | NNNZZTVVLYDCQX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.25 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|