C20H30O2 — CID 21028950
8-hydroxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-chrysen-2-one (PubChem CID 21028950) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 8-hydroxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-chrysen-2-one.
| Compound Name | 8-hydroxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-chrysen-2-one |
|---|---|
| PubChem CID | 21028950 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 8-hydroxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-chrysen-2-one |
| SMILES | CC12CCC3C(CC=C4CC(O)CCC43C)C1CCC(=O)C2 |
| InChI | InChI=1S/C20H30O2/c1-19-9-8-18-16(17(19)6-4-15(22)12-19)5-3-13-11-14(21)7-10-20(13,18)2/h3,14,16-18,21H,4-12H2,1-2H3 |
| InChIKey | PGRNQQYBFRNPSE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|