C21H13N — CID 21029068
N,N-bis(hexa-1,3,5-triynyl)-3,4,5-trimethylaniline (PubChem CID 21029068) has the molecular formula C21H13N and a molecular weight of 279.34 g/mol. Its IUPAC name is N,N-bis(hexa-1,3,5-triynyl)-3,4,5-trimethylaniline.
| Compound Name | N,N-bis(hexa-1,3,5-triynyl)-3,4,5-trimethylaniline |
|---|---|
| PubChem CID | 21029068 |
| Molecular Formula | C21H13N |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N,N-bis(hexa-1,3,5-triynyl)-3,4,5-trimethylaniline |
| SMILES | C#CC#CC#CN(C#CC#CC#C)c1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C21H13N/c1-6-8-10-12-14-22(15-13-11-9-7-2)21-16-18(3)20(5)19(4)17-21/h1-2,16-17H,3-5H3 |
| InChIKey | IWAGMMMQZOASSZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|