C26H30N4 — CID 21029087
(E)-1-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N-[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]methanimine (PubChem CID 21029087) has the molecular formula C26H30N4 and a molecular weight of 398.55 g/mol. Its IUPAC name is (E)-1-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N-[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]methanimine.
| Compound Name | (E)-1-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N-[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]methanimine |
|---|---|
| PubChem CID | 21029087 |
| Molecular Formula | C26H30N4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (E)-1-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N-[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]methanimine |
| SMILES | C(=N/N=C/c1cc2c3c(c1)CCCN3CCC2)\c1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C26H30N4/c1-5-21-13-19(14-22-6-2-10-29(9-1)25(21)22)17-27-28-18-20-15-23-7-3-11-30-12-4-8-24(16-20)26(23)30/h13-18H,1-12H2/b27-17+,28-18+ |
| InChIKey | KOPDLKFRJZVRAV-XUIWWLCJSA-N |
| XLogP | 4.54 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|