About 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one
5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 21029392) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| PubChem CID | 21029392 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | CC(C)(C)N1CCC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-13(2,3)15-9-8-12(16)14-10-6-4-5-7-11(10)15/h4-7H,8-9H2,1-3H3,(H,14,16) |
| InChIKey | OPYXLZPEQMYUFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
The IUPAC name of 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one (CID 21029392) is 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
What is the SMILES notation for 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
The canonical SMILES for 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one is CC(C)(C)N1CCC(=O)Nc2ccccc21.
What is the InChIKey of 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
The InChIKey is OPYXLZPEQMYUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-13(2,3)15-9-8-12(16)14-10-6-4-5-7-11(10)15/h4-7H,8-9H2,1-3H3,(H,14,16).
What are the key properties of 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one has a molecular weight of 218.30 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one is sourced from PubChem (CID 21029392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).