About diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate
diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate (PubChem CID 21029819) has the molecular formula C27H31N5O5
and a molecular weight of 505.58 g/mol. Its IUPAC name is diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate.
Molecular Properties
| Compound Name | diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate |
| PubChem CID | 21029819 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate |
| SMILES | C=C(CC(NC(=O)c1ccc(CCc2ccc3nc(N)nc(N)c3c2)cc1)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H31N5O5/c1-4-36-25(34)16(3)14-22(26(35)37-5-2)30-24(33)19-11-8-17(9-12-19)6-7-18-10-13-21-20(15-18)23(28)32-27(29)31-21/h8-13,15,22H,3-7,14H2,1-2H3,(H,30,33)(H4,28,29,31,32) |
| InChIKey | COIGYSFWURAAIG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate?
The IUPAC name of diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate (CID 21029819) is diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate.
What is the SMILES notation for diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate?
The canonical SMILES for diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate is C=C(CC(NC(=O)c1ccc(CCc2ccc3nc(N)nc(N)c3c2)cc1)C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate?
The InChIKey is COIGYSFWURAAIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N5O5/c1-4-36-25(34)16(3)14-22(26(35)37-5-2)30-24(33)19-11-8-17(9-12-19)6-7-18-10-13-21-20(15-18)23(28)32-27(29)31-21/h8-13,15,22H,3-7,14H2,1-2H3,(H,30,33)(H4,28,29,31,32).
What are the key properties of diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate?
diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate has a molecular weight of 505.58 g/mol, XLogP of 2.75, 11 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate is sourced from PubChem (CID 21029819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).